C13H16N4O2S — CID 60986935
3-amino-5-(1-pyridin-2-ylethylamino)benzenesulfonamide (PubChem CID 60986935) has the molecular formula C13H16N4O2S and a molecular weight of 292.36 g/mol. Its IUPAC name is 3-amino-5-(1-pyridin-2-ylethylamino)benzenesulfonamide.
| Compound Name | 3-amino-5-(1-pyridin-2-ylethylamino)benzenesulfonamide |
|---|---|
| PubChem CID | 60986935 |
| Molecular Formula | C13H16N4O2S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.10 |
| IUPAC Name | 3-amino-5-(1-pyridin-2-ylethylamino)benzenesulfonamide |
| SMILES | CC(Nc1cc(N)cc(S(N)(=O)=O)c1)c1ccccn1 |
| InChI | InChI=1S/C13H16N4O2S/c1-9(13-4-2-3-5-16-13)17-11-6-10(14)7-12(8-11)20(15,18)19/h2-9,17H,14H2,1H3,(H2,15,18,19) |
| InChIKey | AIEPNFGMCVMBCM-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|