C16H22N4O2 — CID 91481127
3-[4-amino-2-[(4-aminoanilino)methyl]anilino]propane-1,1-diol (PubChem CID 91481127) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 3-[4-amino-2-[(4-aminoanilino)methyl]anilino]propane-1,1-diol.
| Compound Name | 3-[4-amino-2-[(4-aminoanilino)methyl]anilino]propane-1,1-diol |
|---|---|
| PubChem CID | 91481127 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 3-[4-amino-2-[(4-aminoanilino)methyl]anilino]propane-1,1-diol |
| SMILES | Nc1ccc(NCc2cc(N)ccc2NCCC(O)O)cc1 |
| InChI | InChI=1S/C16H22N4O2/c17-12-1-4-14(5-2-12)20-10-11-9-13(18)3-6-15(11)19-8-7-16(21)22/h1-6,9,16,19-22H,7-8,10,17-18H2 |
| InChIKey | CAIFPQJVLCYGTB-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 116.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|