C17H24N4O2 — CID 22662312
1-[4-[(2,5-diaminophenyl)methylamino]-N-(1-hydroxyethyl)anilino]ethanol (PubChem CID 22662312) has the molecular formula C17H24N4O2 and a molecular weight of 316.41 g/mol. Its IUPAC name is 1-[4-[(2,5-diaminophenyl)methylamino]-N-(1-hydroxyethyl)anilino]ethanol.
| Compound Name | 1-[4-[(2,5-diaminophenyl)methylamino]-N-(1-hydroxyethyl)anilino]ethanol |
|---|---|
| PubChem CID | 22662312 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 1-[4-[(2,5-diaminophenyl)methylamino]-N-(1-hydroxyethyl)anilino]ethanol |
| SMILES | CC(O)N(c1ccc(NCc2cc(N)ccc2N)cc1)C(C)O |
| InChI | InChI=1S/C17H24N4O2/c1-11(22)21(12(2)23)16-6-4-15(5-7-16)20-10-13-9-14(18)3-8-17(13)19/h3-9,11-12,20,22-23H,10,18-19H2,1-2H3 |
| InChIKey | KXOLPCGRAWVWQC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|