C12H20N2O — CID 70408787
1-(4-amino-N,3-diethylanilino)ethanol (PubChem CID 70408787) has the molecular formula C12H20N2O and a molecular weight of 208.30 g/mol. Its IUPAC name is 1-(4-amino-N,3-diethylanilino)ethanol.
| Compound Name | 1-(4-amino-N,3-diethylanilino)ethanol |
|---|---|
| PubChem CID | 70408787 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 1-(4-amino-N,3-diethylanilino)ethanol |
| SMILES | CCc1cc(N(CC)C(C)O)ccc1N |
| InChI | InChI=1S/C12H20N2O/c1-4-10-8-11(6-7-12(10)13)14(5-2)9(3)15/h6-9,15H,4-5,13H2,1-3H3 |
| InChIKey | KUNGSOFNGRQZFV-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|