C22H34N4O6S — CID 21412880
bis[4-[ethyl(1-hydroxyethyl)amino]-2-methylanilino] sulfate (PubChem CID 21412880) has the molecular formula C22H34N4O6S and a molecular weight of 482.60 g/mol. Its IUPAC name is bis[4-[ethyl(1-hydroxyethyl)amino]-2-methylanilino] sulfate.
| Compound Name | bis[4-[ethyl(1-hydroxyethyl)amino]-2-methylanilino] sulfate |
|---|---|
| PubChem CID | 21412880 |
| Molecular Formula | C22H34N4O6S |
| Molecular Weight | 482.60 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | bis[4-[ethyl(1-hydroxyethyl)amino]-2-methylanilino] sulfate |
| SMILES | CCN(c1ccc(NOS(=O)(=O)ONc2ccc(N(CC)C(C)O)cc2C)c(C)c1)C(C)O |
| InChI | InChI=1S/C22H34N4O6S/c1-7-25(17(5)27)19-9-11-21(15(3)13-19)23-31-33(29,30)32-24-22-12-10-20(14-16(22)4)26(8-2)18(6)28/h9-14,17-18,23-24,27-28H,7-8H2,1-6H3 |
| InChIKey | QTJFXXVYVAJZIW-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 123.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.60 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|