C13H22ClN3O5 — CID 139984333
1-[4-[ethyl(1-hydroxyethyl)amino]-2-nitroanilino]propane-1,1-diol;hydrochloride (PubChem CID 139984333) has the molecular formula C13H22ClN3O5 and a molecular weight of 335.79 g/mol. Its IUPAC name is 1-[4-[ethyl(1-hydroxyethyl)amino]-2-nitroanilino]propane-1,1-diol;hydrochloride.
| Compound Name | 1-[4-[ethyl(1-hydroxyethyl)amino]-2-nitroanilino]propane-1,1-diol;hydrochloride |
|---|---|
| PubChem CID | 139984333 |
| Molecular Formula | C13H22ClN3O5 |
| Molecular Weight | 335.79 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | 1-[4-[ethyl(1-hydroxyethyl)amino]-2-nitroanilino]propane-1,1-diol;hydrochloride |
| SMILES | CCN(c1ccc(NC(O)(O)CC)c([N+](=O)[O-])c1)C(C)O.Cl |
| InChI | InChI=1S/C13H21N3O5.ClH/c1-4-13(18,19)14-11-7-6-10(8-12(11)16(20)21)15(5-2)9(3)17;/h6-9,14,17-19H,4-5H2,1-3H3;1H |
| InChIKey | AMSIFIMIJSTPOJ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 119.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.79 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|