C12H17BrN2O3 — CID 103952450
3-(4-bromo-2-nitroanilino)-2,3-dimethylbutan-2-ol (PubChem CID 103952450) has the molecular formula C12H17BrN2O3 and a molecular weight of 317.18 g/mol. Its IUPAC name is 3-(4-bromo-2-nitroanilino)-2,3-dimethylbutan-2-ol.
| Compound Name | 3-(4-bromo-2-nitroanilino)-2,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 103952450 |
| Molecular Formula | C12H17BrN2O3 |
| Molecular Weight | 317.18 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | 3-(4-bromo-2-nitroanilino)-2,3-dimethylbutan-2-ol |
| SMILES | CC(C)(O)C(C)(C)Nc1ccc(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H17BrN2O3/c1-11(2,12(3,4)16)14-9-6-5-8(13)7-10(9)15(17)18/h5-7,14,16H,1-4H3 |
| InChIKey | JYHGIGMMDVEZGY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.18 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|