C11H13BrN2O4 — CID 174629646
(4-bromo-2-nitroanilino) 2,2-dimethylpropanoate (PubChem CID 174629646) has the molecular formula C11H13BrN2O4 and a molecular weight of 317.14 g/mol. Its IUPAC name is (4-bromo-2-nitroanilino) 2,2-dimethylpropanoate.
| Compound Name | (4-bromo-2-nitroanilino) 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 174629646 |
| Molecular Formula | C11H13BrN2O4 |
| Molecular Weight | 317.14 g/mol |
| Exact Mass | 316.01 |
| IUPAC Name | (4-bromo-2-nitroanilino) 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)ONc1ccc(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H13BrN2O4/c1-11(2,3)10(15)18-13-8-5-4-7(12)6-9(8)14(16)17/h4-6,13H,1-3H3 |
| InChIKey | GPGQLZCPTAIIAZ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.14 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|