C14H18N4O — CID 18371271
2-[4-amino-3-(3,5-diaminophenyl)anilino]ethanol (PubChem CID 18371271) has the molecular formula C14H18N4O and a molecular weight of 258.33 g/mol. Its IUPAC name is 2-[4-amino-3-(3,5-diaminophenyl)anilino]ethanol.
| Compound Name | 2-[4-amino-3-(3,5-diaminophenyl)anilino]ethanol |
|---|---|
| PubChem CID | 18371271 |
| Molecular Formula | C14H18N4O |
| Molecular Weight | 258.33 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | 2-[4-amino-3-(3,5-diaminophenyl)anilino]ethanol |
| SMILES | Nc1cc(N)cc(-c2cc(NCCO)ccc2N)c1 |
| InChI | InChI=1S/C14H18N4O/c15-10-5-9(6-11(16)7-10)13-8-12(18-3-4-19)1-2-14(13)17/h1-2,5-8,18-19H,3-4,15-17H2 |
| InChIKey | SLTKUMXMGWJLHK-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 110.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.33 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|