C15H22N4O2 — CID 159575611
2-(3-amino-4-methoxyanilino)ethanol;benzene-1,3-diamine (PubChem CID 159575611) has the molecular formula C15H22N4O2 and a molecular weight of 290.37 g/mol. Its IUPAC name is 2-(3-amino-4-methoxyanilino)ethanol;benzene-1,3-diamine.
| Compound Name | 2-(3-amino-4-methoxyanilino)ethanol;benzene-1,3-diamine |
|---|---|
| PubChem CID | 159575611 |
| Molecular Formula | C15H22N4O2 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | 2-(3-amino-4-methoxyanilino)ethanol;benzene-1,3-diamine |
| SMILES | COc1ccc(NCCO)cc1N.Nc1cccc(N)c1 |
| InChI | InChI=1S/C9H14N2O2.C6H8N2/c1-13-9-3-2-7(6-8(9)10)11-4-5-12;7-5-2-1-3-6(8)4-5/h2-3,6,11-12H,4-5,10H2,1H3;1-4H,7-8H2 |
| InChIKey | MIJDYRLRQWIXKB-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 119.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|