C24H32N6O4 — CID 69033060
2-[4-[[1,3-bis(2,4-diaminophenoxy)propan-2-ylamino]methoxy]anilino]ethanol (PubChem CID 69033060) has the molecular formula C24H32N6O4 and a molecular weight of 468.56 g/mol. Its IUPAC name is 2-[4-[[1,3-bis(2,4-diaminophenoxy)propan-2-ylamino]methoxy]anilino]ethanol.
| Compound Name | 2-[4-[[1,3-bis(2,4-diaminophenoxy)propan-2-ylamino]methoxy]anilino]ethanol |
|---|---|
| PubChem CID | 69033060 |
| Molecular Formula | C24H32N6O4 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | 2-[4-[[1,3-bis(2,4-diaminophenoxy)propan-2-ylamino]methoxy]anilino]ethanol |
| SMILES | Nc1ccc(OCC(COc2ccc(N)cc2N)NCOc2ccc(NCCO)cc2)c(N)c1 |
| InChI | InChI=1S/C24H32N6O4/c25-16-1-7-23(21(27)11-16)32-13-19(14-33-24-8-2-17(26)12-22(24)28)30-15-34-20-5-3-18(4-6-20)29-9-10-31/h1-8,11-12,19,29-31H,9-10,13-15,25-28H2 |
| InChIKey | YLPHIEIEZBOENJ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 176.06 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|