C13H20FNO2 — CID 56811844
1-(2-fluorophenyl)-2-[2-hydroxyethyl(propyl)amino]ethanol (PubChem CID 56811844) has the molecular formula C13H20FNO2 and a molecular weight of 241.31 g/mol. Its IUPAC name is 1-(2-fluorophenyl)-2-[2-hydroxyethyl(propyl)amino]ethanol.
| Compound Name | 1-(2-fluorophenyl)-2-[2-hydroxyethyl(propyl)amino]ethanol |
|---|---|
| PubChem CID | 56811844 |
| Molecular Formula | C13H20FNO2 |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 1-(2-fluorophenyl)-2-[2-hydroxyethyl(propyl)amino]ethanol |
| SMILES | CCCN(CCO)CC(O)c1ccccc1F |
| InChI | InChI=1S/C13H20FNO2/c1-2-7-15(8-9-16)10-13(17)11-5-3-4-6-12(11)14/h3-6,13,16-17H,2,7-10H2,1H3 |
| InChIKey | UYHUWINIAGLJOP-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |