C25H30N4O3 — CID 123780677
4-[4-(butylamino)phenyl]imino-6-[4-(ethylamino)phenyl]imino-2-methoxycyclohexane-1,3-dione (PubChem CID 123780677) has the molecular formula C25H30N4O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is 4-[4-(butylamino)phenyl]imino-6-[4-(ethylamino)phenyl]imino-2-methoxycyclohexane-1,3-dione.
| Compound Name | 4-[4-(butylamino)phenyl]imino-6-[4-(ethylamino)phenyl]imino-2-methoxycyclohexane-1,3-dione |
|---|---|
| PubChem CID | 123780677 |
| Molecular Formula | C25H30N4O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | 4-[4-(butylamino)phenyl]imino-6-[4-(ethylamino)phenyl]imino-2-methoxycyclohexane-1,3-dione |
| SMILES | CCCCNc1ccc(/N=C2\C/C(=N/c3ccc(NCC)cc3)C(=O)C(OC)C2=O)cc1 |
| InChI | InChI=1S/C25H30N4O3/c1-4-6-15-27-18-9-13-20(14-10-18)29-22-16-21(23(30)25(32-3)24(22)31)28-19-11-7-17(8-12-19)26-5-2/h7-14,25-27H,4-6,15-16H2,1-3H3/b28-21-,29-22+ |
| InChIKey | YCIHFLBPLVRDHC-FJYRUYPUSA-N |
| XLogP | 4.73 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|