C16H27NO2 — CID 83961551
N-butyl-3,4-dipropoxyaniline (PubChem CID 83961551) has the molecular formula C16H27NO2 and a molecular weight of 265.40 g/mol. Its IUPAC name is N-butyl-3,4-dipropoxyaniline.
| Compound Name | N-butyl-3,4-dipropoxyaniline |
|---|---|
| PubChem CID | 83961551 |
| Molecular Formula | C16H27NO2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | N-butyl-3,4-dipropoxyaniline |
| SMILES | CCCCNc1ccc(OCCC)c(OCCC)c1 |
| InChI | InChI=1S/C16H27NO2/c1-4-7-10-17-14-8-9-15(18-11-5-2)16(13-14)19-12-6-3/h8-9,13,17H,4-7,10-12H2,1-3H3 |
| InChIKey | GBDKGYRZDLEZMN-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|