C14H23NO2S — CID 83961561
2-(3,4-dipropoxyanilino)ethanethiol (PubChem CID 83961561) has the molecular formula C14H23NO2S and a molecular weight of 269.41 g/mol. Its IUPAC name is 2-(3,4-dipropoxyanilino)ethanethiol.
| Compound Name | 2-(3,4-dipropoxyanilino)ethanethiol |
|---|---|
| PubChem CID | 83961561 |
| Molecular Formula | C14H23NO2S |
| Molecular Weight | 269.41 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 2-(3,4-dipropoxyanilino)ethanethiol |
| SMILES | CCCOc1ccc(NCCS)cc1OCCC |
| InChI | InChI=1S/C14H23NO2S/c1-3-8-16-13-6-5-12(15-7-10-18)11-14(13)17-9-4-2/h5-6,11,15,18H,3-4,7-10H2,1-2H3 |
| InChIKey | SLVILBLNOREGCU-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.41 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|