C19H24FNO2 — CID 83961565
N-[(2-fluorophenyl)methyl]-3,4-dipropoxyaniline (PubChem CID 83961565) has the molecular formula C19H24FNO2 and a molecular weight of 317.40 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-3,4-dipropoxyaniline.
| Compound Name | N-[(2-fluorophenyl)methyl]-3,4-dipropoxyaniline |
|---|---|
| PubChem CID | 83961565 |
| Molecular Formula | C19H24FNO2 |
| Molecular Weight | 317.40 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-3,4-dipropoxyaniline |
| SMILES | CCCOc1ccc(NCc2ccccc2F)cc1OCCC |
| InChI | InChI=1S/C19H24FNO2/c1-3-11-22-18-10-9-16(13-19(18)23-12-4-2)21-14-15-7-5-6-8-17(15)20/h5-10,13,21H,3-4,11-12,14H2,1-2H3 |
| InChIKey | ZLCWFDQBIMVUHQ-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.40 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|