C30H45N7O — CID 91460158
5-amino-2,4-bis[4-[2-(diethylamino)ethylamino]anilino]phenol (PubChem CID 91460158) has the molecular formula C30H45N7O and a molecular weight of 519.74 g/mol. Its IUPAC name is 5-amino-2,4-bis[4-[2-(diethylamino)ethylamino]anilino]phenol.
| Compound Name | 5-amino-2,4-bis[4-[2-(diethylamino)ethylamino]anilino]phenol |
|---|---|
| PubChem CID | 91460158 |
| Molecular Formula | C30H45N7O |
| Molecular Weight | 519.74 g/mol |
| Exact Mass | 519.37 |
| IUPAC Name | 5-amino-2,4-bis[4-[2-(diethylamino)ethylamino]anilino]phenol |
| SMILES | CCN(CC)CCNc1ccc(Nc2cc(Nc3ccc(NCCN(CC)CC)cc3)c(O)cc2N)cc1 |
| InChI | InChI=1S/C30H45N7O/c1-5-36(6-2)19-17-32-23-9-13-25(14-10-23)34-28-22-29(30(38)21-27(28)31)35-26-15-11-24(12-16-26)33-18-20-37(7-3)8-4/h9-16,21-22,32-35,38H,5-8,17-20,31H2,1-4H3 |
| InChIKey | PKCIQEKZCGDETG-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 100.85 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.74 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|