C36H61N8O+3 — CID 142375428
3-[4-[2-amino-5-[4-[bis[3-(trimethylazaniumyl)propyl]amino]anilino]-4-hydroxyanilino]anilino]propyl-trimethylazanium (PubChem CID 142375428) has the molecular formula C36H61N8O+3 and a molecular weight of 621.94 g/mol. Its IUPAC name is 3-[4-[2-amino-5-[4-[bis[3-(trimethylazaniumyl)propyl]amino]anilino]-4-hydroxyanilino]anilino]propyl-trimethylazanium.
| Compound Name | 3-[4-[2-amino-5-[4-[bis[3-(trimethylazaniumyl)propyl]amino]anilino]-4-hydroxyanilino]anilino]propyl-trimethylazanium |
|---|---|
| PubChem CID | 142375428 |
| Molecular Formula | C36H61N8O+3 |
| Molecular Weight | 621.94 g/mol |
| Exact Mass | 621.50 |
| IUPAC Name | 3-[4-[2-amino-5-[4-[bis[3-(trimethylazaniumyl)propyl]amino]anilino]-4-hydroxyanilino]anilino]propyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCCNc1ccc(Nc2cc(Nc3ccc(N(CCC[N+](C)(C)C)CCC[N+](C)(C)C)cc3)c(O)cc2N)cc1 |
| InChI | InChI=1S/C36H60N8O/c1-42(2,3)24-10-21-38-29-13-15-30(16-14-29)39-34-28-35(36(45)27-33(34)37)40-31-17-19-32(20-18-31)41(22-11-25-43(4,5)6)23-12-26-44(7,8)9/h13-20,27-28,38-40H,10-12,21-26,37H2,1-9H3/q+2/p+1 |
| InChIKey | LWRKSVNYWSFFKF-UHFFFAOYSA-O |
| XLogP | 5.97 |
| TPSA | 85.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.94 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|