C34H42N8O2+2 — CID 143820240
4-[4-[ethyl-[2-(1H-imidazol-3-ium-3-yl)ethyl]amino]anilino]-6-[4-[ethyl-[2-(3-methylimidazol-3-ium-1-yl)ethyl]amino]phenyl]imino-3-hydroxy-2-methylcyclohexa-2,4-dien-1-one (PubChem CID 143820240) has the molecular formula C34H42N8O2+2 and a molecular weight of 594.76 g/mol. Its IUPAC name is 4-[4-[ethyl-[2-(1H-imidazol-3-ium-3-yl)ethyl]amino]anilino]-6-[4-[ethyl-[2-(3-methylimidazol-3-ium-1-yl)ethyl]amino]phenyl]imino-3-hydroxy-2-methylcyclohexa-2,4-dien-1-one.
| Compound Name | 4-[4-[ethyl-[2-(1H-imidazol-3-ium-3-yl)ethyl]amino]anilino]-6-[4-[ethyl-[2-(3-methylimidazol-3-ium-1-yl)ethyl]amino]phenyl]imino-3-hydroxy-2-methylcyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 143820240 |
| Molecular Formula | C34H42N8O2+2 |
| Molecular Weight | 594.76 g/mol |
| Exact Mass | 594.34 |
| IUPAC Name | 4-[4-[ethyl-[2-(1H-imidazol-3-ium-3-yl)ethyl]amino]anilino]-6-[4-[ethyl-[2-(3-methylimidazol-3-ium-1-yl)ethyl]amino]phenyl]imino-3-hydroxy-2-methylcyclohexa-2,4-dien-1-one |
| SMILES | CCN(CCn1cc[n+](C)c1)c1ccc(/N=C2/C=C(Nc3ccc(N(CC)CC[n+]4cc[nH]c4)cc3)C(O)=C(C)C2=O)cc1 |
| InChI | InChI=1S/C34H40N8O2/c1-5-41(21-19-39-16-15-35-24-39)29-11-7-27(8-12-29)36-31-23-32(34(44)26(3)33(31)43)37-28-9-13-30(14-10-28)42(6-2)22-20-40-18-17-38(4)25-40/h7-18,23-25H,5-6,19-22H2,1-4H3,(H-,36,37,43,44)/p+2 |
| InChIKey | HAYCTOHTVFBSKJ-UHFFFAOYSA-P |
| XLogP | 4.46 |
| TPSA | 96.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.76 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|