C7H15N3O4S — CID 87189464
2-(3-methylimidazol-3-ium-1-yl)ethanamine;methyl sulfate (PubChem CID 87189464) has the molecular formula C7H15N3O4S and a molecular weight of 237.28 g/mol. Its IUPAC name is 2-(3-methylimidazol-3-ium-1-yl)ethanamine;methyl sulfate.
| Compound Name | 2-(3-methylimidazol-3-ium-1-yl)ethanamine;methyl sulfate |
|---|---|
| PubChem CID | 87189464 |
| Molecular Formula | C7H15N3O4S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 2-(3-methylimidazol-3-ium-1-yl)ethanamine;methyl sulfate |
| SMILES | COS(=O)(=O)[O-].C[n+]1ccn(CCN)c1 |
| InChI | InChI=1S/C6H12N3.CH4O4S/c1-8-4-5-9(6-8)3-2-7;1-5-6(2,3)4/h4-6H,2-3,7H2,1H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | LGIQGKYIGQHEJX-UHFFFAOYSA-M |
| XLogP | -1.64 |
| TPSA | 101.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|