C34H32BrN9O4 — CID 87580529
4-[[4-[(E)-[bis(4-nitrophenyl)methylidenehydrazinylidene]methyl]phenyl]diazenyl]-N-ethyl-N-[2-(3-methylimidazol-3-ium-1-yl)ethyl]aniline bromide (PubChem CID 87580529) has the molecular formula C34H32BrN9O4 and a molecular weight of 710.59 g/mol. Its IUPAC name is 4-[[4-[(E)-[bis(4-nitrophenyl)methylidenehydrazinylidene]methyl]phenyl]diazenyl]-N-ethyl-N-[2-(3-methylimidazol-3-ium-1-yl)ethyl]aniline bromide.
| Compound Name | 4-[[4-[(E)-[bis(4-nitrophenyl)methylidenehydrazinylidene]methyl]phenyl]diazenyl]-N-ethyl-N-[2-(3-methylimidazol-3-ium-1-yl)ethyl]aniline bromide |
|---|---|
| PubChem CID | 87580529 |
| Molecular Formula | C34H32BrN9O4 |
| Molecular Weight | 710.59 g/mol |
| Exact Mass | 709.18 |
| IUPAC Name | 4-[[4-[(E)-[bis(4-nitrophenyl)methylidenehydrazinylidene]methyl]phenyl]diazenyl]-N-ethyl-N-[2-(3-methylimidazol-3-ium-1-yl)ethyl]aniline bromide |
| SMILES | CCN(CCn1cc[n+](C)c1)c1ccc(/N=N/c2ccc(/C=N/N=C(c3ccc([N+](=O)[O-])cc3)c3ccc([N+](=O)[O-])cc3)cc2)cc1.[Br-] |
| InChI | InChI=1S/C34H32N9O4.BrH/c1-3-41(23-22-40-21-20-39(2)25-40)31-18-12-30(13-19-31)37-36-29-10-4-26(5-11-29)24-35-38-34(27-6-14-32(15-7-27)42(44)45)28-8-16-33(17-9-28)43(46)47;/h4-21,24-25H,3,22-23H2,1-2H3;1H/q+1;/p-1/b35-24+,37-36+; |
| InChIKey | CTSLASSEQCURDH-ISZYOMJHSA-M |
| XLogP | 3.95 |
| TPSA | 147.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.59 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|