C29H39N5O4S — CID 87673229
4-[C-[4-(diethylamino)phenyl]-N-[(1-methylpyridin-1-ium-4-yl)methylideneamino]carbonimidoyl]-N,N-diethylaniline;methyl sulfate (PubChem CID 87673229) has the molecular formula C29H39N5O4S and a molecular weight of 553.73 g/mol. Its IUPAC name is 4-[C-[4-(diethylamino)phenyl]-N-[(1-methylpyridin-1-ium-4-yl)methylideneamino]carbonimidoyl]-N,N-diethylaniline;methyl sulfate.
| Compound Name | 4-[C-[4-(diethylamino)phenyl]-N-[(1-methylpyridin-1-ium-4-yl)methylideneamino]carbonimidoyl]-N,N-diethylaniline;methyl sulfate |
|---|---|
| PubChem CID | 87673229 |
| Molecular Formula | C29H39N5O4S |
| Molecular Weight | 553.73 g/mol |
| Exact Mass | 553.27 |
| IUPAC Name | 4-[C-[4-(diethylamino)phenyl]-N-[(1-methylpyridin-1-ium-4-yl)methylideneamino]carbonimidoyl]-N,N-diethylaniline;methyl sulfate |
| SMILES | CCN(CC)c1ccc(C(=NN=Cc2cc[n+](C)cc2)c2ccc(N(CC)CC)cc2)cc1.COS(=O)(=O)[O-] |
| InChI | InChI=1S/C28H36N5.CH4O4S/c1-6-32(7-2)26-14-10-24(11-15-26)28(30-29-22-23-18-20-31(5)21-19-23)25-12-16-27(17-13-25)33(8-3)9-4;1-5-6(2,3)4/h10-22H,6-9H2,1-5H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | ITIJNEOYRDKZBS-UHFFFAOYSA-M |
| XLogP | 4.17 |
| TPSA | 101.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.73 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|