C21H23F3N2O3S2 — CID 160823006
N,N-diethyl-4-[5-(1-methylpyridin-1-ium-4-yl)thiophen-2-yl]aniline;trifluoromethanesulfonate (PubChem CID 160823006) has the molecular formula C21H23F3N2O3S2 and a molecular weight of 472.55 g/mol. Its IUPAC name is N,N-diethyl-4-[5-(1-methylpyridin-1-ium-4-yl)thiophen-2-yl]aniline;trifluoromethanesulfonate.
| Compound Name | N,N-diethyl-4-[5-(1-methylpyridin-1-ium-4-yl)thiophen-2-yl]aniline;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 160823006 |
| Molecular Formula | C21H23F3N2O3S2 |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | N,N-diethyl-4-[5-(1-methylpyridin-1-ium-4-yl)thiophen-2-yl]aniline;trifluoromethanesulfonate |
| SMILES | CCN(CC)c1ccc(-c2ccc(-c3cc[n+](C)cc3)s2)cc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C20H23N2S.CHF3O3S/c1-4-22(5-2)18-8-6-16(7-9-18)19-10-11-20(23-19)17-12-14-21(3)15-13-17;2-1(3,4)8(5,6)7/h6-15H,4-5H2,1-3H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | SFUGJUMNZSZGRV-UHFFFAOYSA-M |
| XLogP | 4.80 |
| TPSA | 64.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|