C25H30BrN5O — CID 87673373
2-[4-[(E)-[bis[4-(dimethylamino)phenyl]methylidenehydrazinylidene]methyl]pyridin-1-ium-1-yl]ethanol bromide (PubChem CID 87673373) has the molecular formula C25H30BrN5O and a molecular weight of 496.45 g/mol. Its IUPAC name is 2-[4-[(E)-[bis[4-(dimethylamino)phenyl]methylidenehydrazinylidene]methyl]pyridin-1-ium-1-yl]ethanol bromide.
| Compound Name | 2-[4-[(E)-[bis[4-(dimethylamino)phenyl]methylidenehydrazinylidene]methyl]pyridin-1-ium-1-yl]ethanol bromide |
|---|---|
| PubChem CID | 87673373 |
| Molecular Formula | C25H30BrN5O |
| Molecular Weight | 496.45 g/mol |
| Exact Mass | 495.16 |
| IUPAC Name | 2-[4-[(E)-[bis[4-(dimethylamino)phenyl]methylidenehydrazinylidene]methyl]pyridin-1-ium-1-yl]ethanol bromide |
| SMILES | CN(C)c1ccc(C(=N/N=C/c2cc[n+](CCO)cc2)c2ccc(N(C)C)cc2)cc1.[Br-] |
| InChI | InChI=1S/C25H30N5O.BrH/c1-28(2)23-9-5-21(6-10-23)25(22-7-11-24(12-8-22)29(3)4)27-26-19-20-13-15-30(16-14-20)17-18-31;/h5-16,19,31H,17-18H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | FAYJZMMGOMLNGM-UHFFFAOYSA-M |
| XLogP | -0.03 |
| TPSA | 55.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.45 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|