C29H30N6O4S — CID 173112369
N,N-dimethyl-4-[[4-[[[(1-methylpyridin-1-ium-4-yl)-phenylmethylidene]hydrazinylidene]methyl]phenyl]diazenyl]aniline;methyl sulfate (PubChem CID 173112369) has the molecular formula C29H30N6O4S and a molecular weight of 558.66 g/mol. Its IUPAC name is N,N-dimethyl-4-[[4-[[[(1-methylpyridin-1-ium-4-yl)-phenylmethylidene]hydrazinylidene]methyl]phenyl]diazenyl]aniline;methyl sulfate.
| Compound Name | N,N-dimethyl-4-[[4-[[[(1-methylpyridin-1-ium-4-yl)-phenylmethylidene]hydrazinylidene]methyl]phenyl]diazenyl]aniline;methyl sulfate |
|---|---|
| PubChem CID | 173112369 |
| Molecular Formula | C29H30N6O4S |
| Molecular Weight | 558.66 g/mol |
| Exact Mass | 558.20 |
| IUPAC Name | N,N-dimethyl-4-[[4-[[[(1-methylpyridin-1-ium-4-yl)-phenylmethylidene]hydrazinylidene]methyl]phenyl]diazenyl]aniline;methyl sulfate |
| SMILES | CN(C)c1ccc(/N=N/c2ccc(C=NN=C(c3ccccc3)c3cc[n+](C)cc3)cc2)cc1.COS(=O)(=O)[O-] |
| InChI | InChI=1S/C28H27N6.CH4O4S/c1-33(2)27-15-13-26(14-16-27)31-30-25-11-9-22(10-12-25)21-29-32-28(23-7-5-4-6-8-23)24-17-19-34(3)20-18-24;1-5-6(2,3)4/h4-21H,1-3H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | QOIYVNJNCONWEJ-UHFFFAOYSA-M |
| XLogP | 4.96 |
| TPSA | 122.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.66 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|