C25H28N2O8S — CID 139082913
3,5-dicarboxybenzenesulfonate;N,N-dimethyl-4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]aniline;methanol (PubChem CID 139082913) has the molecular formula C25H28N2O8S and a molecular weight of 516.57 g/mol. Its IUPAC name is 3,5-dicarboxybenzenesulfonate;N,N-dimethyl-4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]aniline;methanol.
| Compound Name | 3,5-dicarboxybenzenesulfonate;N,N-dimethyl-4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]aniline;methanol |
|---|---|
| PubChem CID | 139082913 |
| Molecular Formula | C25H28N2O8S |
| Molecular Weight | 516.57 g/mol |
| Exact Mass | 516.16 |
| IUPAC Name | 3,5-dicarboxybenzenesulfonate;N,N-dimethyl-4-[(E)-2-(1-methylpyridin-1-ium-4-yl)ethenyl]aniline;methanol |
| SMILES | CN(C)c1ccc(/C=C/c2cc[n+](C)cc2)cc1.CO.O=C(O)c1cc(C(=O)O)cc(S(=O)(=O)[O-])c1 |
| InChI | InChI=1S/C16H19N2.C8H6O7S.CH4O/c1-17(2)16-8-6-14(7-9-16)4-5-15-10-12-18(3)13-11-15;9-7(10)4-1-5(8(11)12)3-6(2-4)16(13,14)15;1-2/h4-13H,1-3H3;1-3H,(H,9,10)(H,11,12)(H,13,14,15);2H,1H3/q+1;;/p-1 |
| InChIKey | CNNARFUFMNXMTR-UHFFFAOYSA-M |
| XLogP | 2.34 |
| TPSA | 159.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.57 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|