C21H27N3O2S — CID 5161686
N,N-dimethyl-4-[[4-(4-methylpiperidin-1-yl)sulfonylphenyl]iminomethyl]aniline (PubChem CID 5161686) has the molecular formula C21H27N3O2S and a molecular weight of 385.53 g/mol. Its IUPAC name is N,N-dimethyl-4-[[4-(4-methylpiperidin-1-yl)sulfonylphenyl]iminomethyl]aniline.
| Compound Name | N,N-dimethyl-4-[[4-(4-methylpiperidin-1-yl)sulfonylphenyl]iminomethyl]aniline |
|---|---|
| PubChem CID | 5161686 |
| Molecular Formula | C21H27N3O2S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | N,N-dimethyl-4-[[4-(4-methylpiperidin-1-yl)sulfonylphenyl]iminomethyl]aniline |
| SMILES | CC1CCN(S(=O)(=O)c2ccc(/N=C/c3ccc(N(C)C)cc3)cc2)CC1 |
| InChI | InChI=1S/C21H27N3O2S/c1-17-12-14-24(15-13-17)27(25,26)21-10-6-19(7-11-21)22-16-18-4-8-20(9-5-18)23(2)3/h4-11,16-17H,12-15H2,1-3H3/b22-16+ |
| InChIKey | DOEWTCPOFZEMNO-CJLVFECKSA-N |
| XLogP | 3.92 |
| TPSA | 52.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|