C24H27N3O2S — CID 3541583
4-[[4-(dimethylamino)phenyl]methylideneamino]-N-(2,4,6-trimethylphenyl)benzenesulfonamide (PubChem CID 3541583) has the molecular formula C24H27N3O2S and a molecular weight of 421.57 g/mol. Its IUPAC name is 4-[[4-(dimethylamino)phenyl]methylideneamino]-N-(2,4,6-trimethylphenyl)benzenesulfonamide.
| Compound Name | 4-[[4-(dimethylamino)phenyl]methylideneamino]-N-(2,4,6-trimethylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 3541583 |
| Molecular Formula | C24H27N3O2S |
| Molecular Weight | 421.57 g/mol |
| Exact Mass | 421.18 |
| IUPAC Name | 4-[[4-(dimethylamino)phenyl]methylideneamino]-N-(2,4,6-trimethylphenyl)benzenesulfonamide |
| SMILES | Cc1cc(C)c(NS(=O)(=O)c2ccc(/N=C/c3ccc(N(C)C)cc3)cc2)c(C)c1 |
| InChI | InChI=1S/C24H27N3O2S/c1-17-14-18(2)24(19(3)15-17)26-30(28,29)23-12-8-21(9-13-23)25-16-20-6-10-22(11-7-20)27(4)5/h6-16,26H,1-5H3/b25-16+ |
| InChIKey | INDSZSIRWWMMON-PCLIKHOPSA-N |
| XLogP | 5.23 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.57 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|