C19H25NO — CID 174445102
4-(dimethylamino)benzaldehyde;1,2,3,5-tetramethylbenzene (PubChem CID 174445102) has the molecular formula C19H25NO and a molecular weight of 283.41 g/mol. Its IUPAC name is 4-(dimethylamino)benzaldehyde;1,2,3,5-tetramethylbenzene.
| Compound Name | 4-(dimethylamino)benzaldehyde;1,2,3,5-tetramethylbenzene |
|---|---|
| PubChem CID | 174445102 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | 4-(dimethylamino)benzaldehyde;1,2,3,5-tetramethylbenzene |
| SMILES | CN(C)c1ccc(C=O)cc1.Cc1cc(C)c(C)c(C)c1 |
| InChI | InChI=1S/C10H14.C9H11NO/c1-7-5-8(2)10(4)9(3)6-7;1-10(2)9-5-3-8(7-11)4-6-9/h5-6H,1-4H3;3-7H,1-2H3 |
| InChIKey | PSPSIRRRVMYUKH-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|