C25H33N5O4S — CID 6382859
N-[2-[(2Z)-2-[[4-(diethylamino)phenyl]methylidene]hydrazinyl]-2-oxoethyl]-4-piperidin-1-ylsulfonylbenzamide (PubChem CID 6382859) has the molecular formula C25H33N5O4S and a molecular weight of 499.64 g/mol. Its IUPAC name is N-[2-[(2Z)-2-[[4-(diethylamino)phenyl]methylidene]hydrazinyl]-2-oxoethyl]-4-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-[2-[(2Z)-2-[[4-(diethylamino)phenyl]methylidene]hydrazinyl]-2-oxoethyl]-4-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 6382859 |
| Molecular Formula | C25H33N5O4S |
| Molecular Weight | 499.64 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | N-[2-[(2Z)-2-[[4-(diethylamino)phenyl]methylidene]hydrazinyl]-2-oxoethyl]-4-piperidin-1-ylsulfonylbenzamide |
| SMILES | CCN(CC)c1ccc(/C=N\NC(=O)CNC(=O)c2ccc(S(=O)(=O)N3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C25H33N5O4S/c1-3-29(4-2)22-12-8-20(9-13-22)18-27-28-24(31)19-26-25(32)21-10-14-23(15-11-21)35(33,34)30-16-6-5-7-17-30/h8-15,18H,3-7,16-17,19H2,1-2H3,(H,26,32)(H,28,31)/b27-18- |
| InChIKey | ZLLGRXDLAGRFHK-IMRQLAEWSA-N |
| XLogP | 2.59 |
| TPSA | 111.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.64 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|