C24H18F5N7O2 — CID 118118878
N-ethyl-4-[(4-nitrophenyl)diazenyl]-N-[2-[5-(2,3,4,5,6-pentafluorophenyl)triazol-1-yl]ethyl]aniline (PubChem CID 118118878) has the molecular formula C24H18F5N7O2 and a molecular weight of 531.45 g/mol. Its IUPAC name is N-ethyl-4-[(4-nitrophenyl)diazenyl]-N-[2-[5-(2,3,4,5,6-pentafluorophenyl)triazol-1-yl]ethyl]aniline.
| Compound Name | N-ethyl-4-[(4-nitrophenyl)diazenyl]-N-[2-[5-(2,3,4,5,6-pentafluorophenyl)triazol-1-yl]ethyl]aniline |
|---|---|
| PubChem CID | 118118878 |
| Molecular Formula | C24H18F5N7O2 |
| Molecular Weight | 531.45 g/mol |
| Exact Mass | 531.14 |
| IUPAC Name | N-ethyl-4-[(4-nitrophenyl)diazenyl]-N-[2-[5-(2,3,4,5,6-pentafluorophenyl)triazol-1-yl]ethyl]aniline |
| SMILES | CCN(CCn1nncc1-c1c(F)c(F)c(F)c(F)c1F)c1ccc(/N=N/c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C24H18F5N7O2/c1-2-34(16-7-3-14(4-8-16)31-32-15-5-9-17(10-6-15)36(37)38)11-12-35-18(13-30-33-35)19-20(25)22(27)24(29)23(28)21(19)26/h3-10,13H,2,11-12H2,1H3/b32-31+ |
| InChIKey | XAODUXCMZRLFNY-QNEJGDQOSA-N |
| XLogP | 6.49 |
| TPSA | 101.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.45 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|