C18H23N4O5S2- — CID 35206132
4-[[4-[ethyl-[2-(methanesulfonamido)ethyl]amino]-2-methylphenyl]diazenyl]benzenesulfonate (PubChem CID 35206132) has the molecular formula C18H23N4O5S2- and a molecular weight of 439.54 g/mol. Its IUPAC name is 4-[[4-[ethyl-[2-(methanesulfonamido)ethyl]amino]-2-methylphenyl]diazenyl]benzenesulfonate.
| Compound Name | 4-[[4-[ethyl-[2-(methanesulfonamido)ethyl]amino]-2-methylphenyl]diazenyl]benzenesulfonate |
|---|---|
| PubChem CID | 35206132 |
| Molecular Formula | C18H23N4O5S2- |
| Molecular Weight | 439.54 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | 4-[[4-[ethyl-[2-(methanesulfonamido)ethyl]amino]-2-methylphenyl]diazenyl]benzenesulfonate |
| SMILES | CCN(CCNS(C)(=O)=O)c1ccc(/N=N/c2ccc(S(=O)(=O)[O-])cc2)c(C)c1 |
| InChI | InChI=1S/C18H24N4O5S2/c1-4-22(12-11-19-28(3,23)24)16-7-10-18(14(2)13-16)21-20-15-5-8-17(9-6-15)29(25,26)27/h5-10,13,19H,4,11-12H2,1-3H3,(H,25,26,27)/p-1/b21-20+ |
| InChIKey | VFPSJIZTRADRII-QZQOTICOSA-M |
| XLogP | 2.69 |
| TPSA | 131.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.54 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|