C15H22N5O4S+ — CID 163430492
2-[N-ethyl-3-methyl-4-[(3-methyl-1H-imidazol-3-ium-2-yl)diazenyl]anilino]ethyl hydrogen sulfate (PubChem CID 163430492) has the molecular formula C15H22N5O4S+ and a molecular weight of 368.44 g/mol. Its IUPAC name is 2-[N-ethyl-3-methyl-4-[(3-methyl-1H-imidazol-3-ium-2-yl)diazenyl]anilino]ethyl hydrogen sulfate.
| Compound Name | 2-[N-ethyl-3-methyl-4-[(3-methyl-1H-imidazol-3-ium-2-yl)diazenyl]anilino]ethyl hydrogen sulfate |
|---|---|
| PubChem CID | 163430492 |
| Molecular Formula | C15H22N5O4S+ |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 2-[N-ethyl-3-methyl-4-[(3-methyl-1H-imidazol-3-ium-2-yl)diazenyl]anilino]ethyl hydrogen sulfate |
| SMILES | CCN(CCOS(=O)(=O)O)c1ccc(/N=N/c2[nH]cc[n+]2C)c(C)c1 |
| InChI | InChI=1S/C15H21N5O4S/c1-4-20(9-10-24-25(21,22)23)13-5-6-14(12(2)11-13)17-18-15-16-7-8-19(15)3/h5-8,11H,4,9-10H2,1-3H3,(H,21,22,23)/p+1/b18-17+ |
| InChIKey | AQBNEQDOHSAPTM-ISLYRVAYSA-O |
| XLogP | 2.21 |
| TPSA | 111.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|