About 2-[4-(1H-benzimidazol-2-yldiazenyl)-N,3-dimethylanilino]ethyl hydrogen sulfite
2-[4-(1H-benzimidazol-2-yldiazenyl)-N,3-dimethylanilino]ethyl hydrogen sulfite (PubChem CID 137227512) has the molecular formula C17H19N5O3S
and a molecular weight of 373.44 g/mol. Its IUPAC name is 2-[4-(1H-benzimidazol-2-yldiazenyl)-N,3-dimethylanilino]ethyl hydrogen sulfite.
Molecular Properties
| Compound Name | 2-[4-(1H-benzimidazol-2-yldiazenyl)-N,3-dimethylanilino]ethyl hydrogen sulfite |
| PubChem CID | 137227512 |
| Molecular Formula | C17H19N5O3S |
| Molecular Weight | 373.44 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 2-[4-(1H-benzimidazol-2-yldiazenyl)-N,3-dimethylanilino]ethyl hydrogen sulfite |
| SMILES | Cc1cc(N(C)CCOS(=O)O)ccc1/N=N/c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C17H19N5O3S/c1-12-11-13(22(2)9-10-25-26(23)24)7-8-14(12)20-21-17-18-15-5-3-4-6-16(15)19-17/h3-8,11H,9-10H2,1-2H3,(H,18,19)(H,23,24)/b21-20+ |
| InChIKey | PEAAFNHUAJEZDC-QZQOTICOSA-N |
| XLogP | 3.88 |
| TPSA | 103.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 373.44 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze 2-[4-(1H-benzimidazol-2-yldiazenyl)-N,3-dimethylanilino]ethyl hydrogen sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(1H-benzimidazol-2-yldiazenyl)-N,3-dimethylanilino]ethyl hydrogen sulfite?
The IUPAC name of 2-[4-(1H-benzimidazol-2-yldiazenyl)-N,3-dimethylanilino]ethyl hydrogen sulfite (CID 137227512) is 2-[4-(1H-benzimidazol-2-yldiazenyl)-N,3-dimethylanilino]ethyl hydrogen sulfite.
What is the SMILES notation for 2-[4-(1H-benzimidazol-2-yldiazenyl)-N,3-dimethylanilino]ethyl hydrogen sulfite?
The canonical SMILES for 2-[4-(1H-benzimidazol-2-yldiazenyl)-N,3-dimethylanilino]ethyl hydrogen sulfite is Cc1cc(N(C)CCOS(=O)O)ccc1/N=N/c1nc2ccccc2[nH]1.
What is the InChIKey of 2-[4-(1H-benzimidazol-2-yldiazenyl)-N,3-dimethylanilino]ethyl hydrogen sulfite?
The InChIKey is PEAAFNHUAJEZDC-QZQOTICOSA-N. The full InChI is InChI=1S/C17H19N5O3S/c1-12-11-13(22(2)9-10-25-26(23)24)7-8-14(12)20-21-17-18-15-5-3-4-6-16(15)19-17/h3-8,11H,9-10H2,1-2H3,(H,18,19)(H,23,24)/b21-20+.
What are the key properties of 2-[4-(1H-benzimidazol-2-yldiazenyl)-N,3-dimethylanilino]ethyl hydrogen sulfite?
2-[4-(1H-benzimidazol-2-yldiazenyl)-N,3-dimethylanilino]ethyl hydrogen sulfite has a molecular weight of 373.44 g/mol, XLogP of 3.88, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(1H-benzimidazol-2-yldiazenyl)-N,3-dimethylanilino]ethyl hydrogen sulfite is sourced from PubChem (CID 137227512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).