C38H58N6O — CID 144565113
2-[[4-[bis(2-ethylhexyl)amino]-2-(methylamino)phenyl]diazenyl]-5-(hexoxymethyl)benzene-1,3-dicarbonitrile (PubChem CID 144565113) has the molecular formula C38H58N6O and a molecular weight of 614.92 g/mol. Its IUPAC name is 2-[[4-[bis(2-ethylhexyl)amino]-2-(methylamino)phenyl]diazenyl]-5-(hexoxymethyl)benzene-1,3-dicarbonitrile.
| Compound Name | 2-[[4-[bis(2-ethylhexyl)amino]-2-(methylamino)phenyl]diazenyl]-5-(hexoxymethyl)benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 144565113 |
| Molecular Formula | C38H58N6O |
| Molecular Weight | 614.92 g/mol |
| Exact Mass | 614.47 |
| IUPAC Name | 2-[[4-[bis(2-ethylhexyl)amino]-2-(methylamino)phenyl]diazenyl]-5-(hexoxymethyl)benzene-1,3-dicarbonitrile |
| SMILES | CCCCCCOCc1cc(C#N)c(/N=N/c2ccc(N(CC(CC)CCCC)CC(CC)CCCC)cc2NC)c(C#N)c1 |
| InChI | InChI=1S/C38H58N6O/c1-7-12-15-16-21-45-29-32-22-33(25-39)38(34(23-32)26-40)43-42-36-20-19-35(24-37(36)41-6)44(27-30(10-4)17-13-8-2)28-31(11-5)18-14-9-3/h19-20,22-24,30-31,41H,7-18,21,27-29H2,1-6H3/b43-42+ |
| InChIKey | PIBMGTMSHOLLIT-HBSCQBRPSA-N |
| XLogP | 11.22 |
| TPSA | 96.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.92 |
| LogP ≤ 5 | 11.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|