C26H34N2O2 — CID 15325929
5,8-bis(hexoxymethyl)naphthalene-2,3-dicarbonitrile (PubChem CID 15325929) has the molecular formula C26H34N2O2 and a molecular weight of 406.57 g/mol. Its IUPAC name is 5,8-bis(hexoxymethyl)naphthalene-2,3-dicarbonitrile.
| Compound Name | 5,8-bis(hexoxymethyl)naphthalene-2,3-dicarbonitrile |
|---|---|
| PubChem CID | 15325929 |
| Molecular Formula | C26H34N2O2 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | 5,8-bis(hexoxymethyl)naphthalene-2,3-dicarbonitrile |
| SMILES | CCCCCCOCc1ccc(COCCCCCC)c2cc(C#N)c(C#N)cc12 |
| InChI | InChI=1S/C26H34N2O2/c1-3-5-7-9-13-29-19-21-11-12-22(20-30-14-10-8-6-4-2)26-16-24(18-28)23(17-27)15-25(21)26/h11-12,15-16H,3-10,13-14,19-20H2,1-2H3 |
| InChIKey | DSDKBPQEIHMKTB-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|