C22H32N2O2 — CID 71348766
4,5-bis(hexoxymethyl)benzene-1,2-dicarbonitrile (PubChem CID 71348766) has the molecular formula C22H32N2O2 and a molecular weight of 356.51 g/mol. Its IUPAC name is 4,5-bis(hexoxymethyl)benzene-1,2-dicarbonitrile.
| Compound Name | 4,5-bis(hexoxymethyl)benzene-1,2-dicarbonitrile |
|---|---|
| PubChem CID | 71348766 |
| Molecular Formula | C22H32N2O2 |
| Molecular Weight | 356.51 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | 4,5-bis(hexoxymethyl)benzene-1,2-dicarbonitrile |
| SMILES | CCCCCCOCc1cc(C#N)c(C#N)cc1COCCCCCC |
| InChI | InChI=1S/C22H32N2O2/c1-3-5-7-9-11-25-17-21-13-19(15-23)20(16-24)14-22(21)18-26-12-10-8-6-4-2/h13-14H,3-12,17-18H2,1-2H3 |
| InChIKey | JHNDANRUJDRKIJ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.51 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|