C26H34N2 — CID 10738197
5,8-diheptylnaphthalene-2,3-dicarbonitrile (PubChem CID 10738197) has the molecular formula C26H34N2 and a molecular weight of 374.57 g/mol. Its IUPAC name is 5,8-diheptylnaphthalene-2,3-dicarbonitrile.
| Compound Name | 5,8-diheptylnaphthalene-2,3-dicarbonitrile |
|---|---|
| PubChem CID | 10738197 |
| Molecular Formula | C26H34N2 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.27 |
| IUPAC Name | 5,8-diheptylnaphthalene-2,3-dicarbonitrile |
| SMILES | CCCCCCCc1ccc(CCCCCCC)c2cc(C#N)c(C#N)cc12 |
| InChI | InChI=1S/C26H34N2/c1-3-5-7-9-11-13-21-15-16-22(14-12-10-8-6-4-2)26-18-24(20-28)23(19-27)17-25(21)26/h15-18H,3-14H2,1-2H3 |
| InChIKey | XYPWQHZOLTWIEF-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|