C44H65N7O6 — CID 157402908
4-[[4-[(2,4-dinitrophenyl)diazenyl]-2,5-bis(2-ethylhexoxy)phenyl]diazenyl]-N-(2-ethylhexyl)-N,3-dimethylaniline (PubChem CID 157402908) has the molecular formula C44H65N7O6 and a molecular weight of 788.05 g/mol. Its IUPAC name is 4-[[4-[(2,4-dinitrophenyl)diazenyl]-2,5-bis(2-ethylhexoxy)phenyl]diazenyl]-N-(2-ethylhexyl)-N,3-dimethylaniline.
| Compound Name | 4-[[4-[(2,4-dinitrophenyl)diazenyl]-2,5-bis(2-ethylhexoxy)phenyl]diazenyl]-N-(2-ethylhexyl)-N,3-dimethylaniline |
|---|---|
| PubChem CID | 157402908 |
| Molecular Formula | C44H65N7O6 |
| Molecular Weight | 788.05 g/mol |
| Exact Mass | 787.50 |
| IUPAC Name | 4-[[4-[(2,4-dinitrophenyl)diazenyl]-2,5-bis(2-ethylhexoxy)phenyl]diazenyl]-N-(2-ethylhexyl)-N,3-dimethylaniline |
| SMILES | CCCCC(CC)COc1cc(/N=N/c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c(OCC(CC)CCCC)cc1/N=N/c1ccc(N(C)CC(CC)CCCC)cc1C |
| InChI | InChI=1S/C44H65N7O6/c1-9-15-18-33(12-4)29-49(8)36-21-23-38(32(7)25-36)45-47-40-27-44(57-31-35(14-6)20-17-11-3)41(28-43(40)56-30-34(13-5)19-16-10-2)48-46-39-24-22-37(50(52)53)26-42(39)51(54)55/h21-28,33-35H,9-20,29-31H2,1-8H3/b47-45+,48-46+ |
| InChIKey | UHTRCJZEWORHLY-MLGMXDONSA-N |
| XLogP | 14.49 |
| TPSA | 157.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.05 |
| LogP ≤ 5 | 14.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|