C29H40N4O4 — CID 137046117
2-ethylhexyl 4-[(1,4-dibutyl-5-cyano-6-hydroxy-2-oxo-3-pyridinyl)diazenyl]benzoate (PubChem CID 137046117) has the molecular formula C29H40N4O4 and a molecular weight of 508.66 g/mol. Its IUPAC name is 2-ethylhexyl 4-[(1,4-dibutyl-5-cyano-6-hydroxy-2-oxo-3-pyridinyl)diazenyl]benzoate.
| Compound Name | 2-ethylhexyl 4-[(1,4-dibutyl-5-cyano-6-hydroxy-2-oxo-3-pyridinyl)diazenyl]benzoate |
|---|---|
| PubChem CID | 137046117 |
| Molecular Formula | C29H40N4O4 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.30 |
| IUPAC Name | 2-ethylhexyl 4-[(1,4-dibutyl-5-cyano-6-hydroxy-2-oxo-3-pyridinyl)diazenyl]benzoate |
| SMILES | CCCCc1c(C#N)c(O)n(CCCC)c(=O)c1/N=N/c1ccc(C(=O)OCC(CC)CCCC)cc1 |
| InChI | InChI=1S/C29H40N4O4/c1-5-9-12-21(8-4)20-37-29(36)22-14-16-23(17-15-22)31-32-26-24(13-10-6-2)25(19-30)27(34)33(28(26)35)18-11-7-3/h14-17,21,34H,5-13,18,20H2,1-4H3/b32-31+ |
| InChIKey | YIOGJCKNRGDWQA-QNEJGDQOSA-N |
| XLogP | 7.36 |
| TPSA | 117.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|