C25H28N4O7 — CID 149204920
[2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] 4-[[5-cyano-6-hydroxy-4-methyl-1-(2-methylpropyl)-2-oxo-3-pyridinyl]diazenyl]benzoate (PubChem CID 149204920) has the molecular formula C25H28N4O7 and a molecular weight of 496.52 g/mol. Its IUPAC name is [2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] 4-[[5-cyano-6-hydroxy-4-methyl-1-(2-methylpropyl)-2-oxo-3-pyridinyl]diazenyl]benzoate.
| Compound Name | [2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] 4-[[5-cyano-6-hydroxy-4-methyl-1-(2-methylpropyl)-2-oxo-3-pyridinyl]diazenyl]benzoate |
|---|---|
| PubChem CID | 149204920 |
| Molecular Formula | C25H28N4O7 |
| Molecular Weight | 496.52 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | [2-hydroxy-3-(2-methylprop-2-enoyloxy)propyl] 4-[[5-cyano-6-hydroxy-4-methyl-1-(2-methylpropyl)-2-oxo-3-pyridinyl]diazenyl]benzoate |
| SMILES | C=C(C)C(=O)OCC(O)COC(=O)c1ccc(/N=N/c2c(C)c(C#N)c(O)n(CC(C)C)c2=O)cc1 |
| InChI | InChI=1S/C25H28N4O7/c1-14(2)11-29-22(31)20(10-26)16(5)21(23(29)32)28-27-18-8-6-17(7-9-18)25(34)36-13-19(30)12-35-24(33)15(3)4/h6-9,14,19,30-31H,3,11-13H2,1-2,4-5H3/b28-27+ |
| InChIKey | MKKQECJCSUVXMH-BYYHNAKLSA-N |
| XLogP | 3.44 |
| TPSA | 163.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.52 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|