C24H36ClN3O — CID 143704125
2-chloro-4-[[1-(2-ethylhexanoyl)pyrrolidin-3-yl]-(3-methylbutyl)amino]benzonitrile (PubChem CID 143704125) has the molecular formula C24H36ClN3O and a molecular weight of 418.03 g/mol. Its IUPAC name is 2-chloro-4-[[1-(2-ethylhexanoyl)pyrrolidin-3-yl]-(3-methylbutyl)amino]benzonitrile.
| Compound Name | 2-chloro-4-[[1-(2-ethylhexanoyl)pyrrolidin-3-yl]-(3-methylbutyl)amino]benzonitrile |
|---|---|
| PubChem CID | 143704125 |
| Molecular Formula | C24H36ClN3O |
| Molecular Weight | 418.03 g/mol |
| Exact Mass | 417.25 |
| IUPAC Name | 2-chloro-4-[[1-(2-ethylhexanoyl)pyrrolidin-3-yl]-(3-methylbutyl)amino]benzonitrile |
| SMILES | CCCCC(CC)C(=O)N1CCC(N(CCC(C)C)c2ccc(C#N)c(Cl)c2)C1 |
| InChI | InChI=1S/C24H36ClN3O/c1-5-7-8-19(6-2)24(29)27-13-12-22(17-27)28(14-11-18(3)4)21-10-9-20(16-26)23(25)15-21/h9-10,15,18-19,22H,5-8,11-14,17H2,1-4H3 |
| InChIKey | OCIFQJQGLGQODF-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 47.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.03 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |