C18H28ClN3O2 — CID 89265603
(2S)-1-[3-[4-amino-3-chloro-N-(3-methylbutyl)anilino]pyrrolidin-1-yl]-2-hydroxypropan-1-one (PubChem CID 89265603) has the molecular formula C18H28ClN3O2 and a molecular weight of 353.89 g/mol. Its IUPAC name is (2S)-1-[3-[4-amino-3-chloro-N-(3-methylbutyl)anilino]pyrrolidin-1-yl]-2-hydroxypropan-1-one.
| Compound Name | (2S)-1-[3-[4-amino-3-chloro-N-(3-methylbutyl)anilino]pyrrolidin-1-yl]-2-hydroxypropan-1-one |
|---|---|
| PubChem CID | 89265603 |
| Molecular Formula | C18H28ClN3O2 |
| Molecular Weight | 353.89 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | (2S)-1-[3-[4-amino-3-chloro-N-(3-methylbutyl)anilino]pyrrolidin-1-yl]-2-hydroxypropan-1-one |
| SMILES | CC(C)CCN(c1ccc(N)c(Cl)c1)C1CCN(C(=O)[C@H](C)O)C1 |
| InChI | InChI=1S/C18H28ClN3O2/c1-12(2)6-9-22(14-4-5-17(20)16(19)10-14)15-7-8-21(11-15)18(24)13(3)23/h4-5,10,12-13,15,23H,6-9,11,20H2,1-3H3/t13-,15?/m0/s1 |
| InChIKey | WZZCDRGGIWINPK-CFMCSPIPSA-N |
| XLogP | 2.76 |
| TPSA | 69.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.89 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|