C23H28ClF2N3O — CID 89265647
1-[(3S)-3-[4-amino-3-chloro-N-[(2,3-difluorophenyl)methyl]anilino]pyrrolidin-1-yl]-2-methylpentan-1-one (PubChem CID 89265647) has the molecular formula C23H28ClF2N3O and a molecular weight of 435.95 g/mol. Its IUPAC name is 1-[(3S)-3-[4-amino-3-chloro-N-[(2,3-difluorophenyl)methyl]anilino]pyrrolidin-1-yl]-2-methylpentan-1-one.
| Compound Name | 1-[(3S)-3-[4-amino-3-chloro-N-[(2,3-difluorophenyl)methyl]anilino]pyrrolidin-1-yl]-2-methylpentan-1-one |
|---|---|
| PubChem CID | 89265647 |
| Molecular Formula | C23H28ClF2N3O |
| Molecular Weight | 435.95 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | 1-[(3S)-3-[4-amino-3-chloro-N-[(2,3-difluorophenyl)methyl]anilino]pyrrolidin-1-yl]-2-methylpentan-1-one |
| SMILES | CCCC(C)C(=O)N1CC[C@H](N(Cc2cccc(F)c2F)c2ccc(N)c(Cl)c2)C1 |
| InChI | InChI=1S/C23H28ClF2N3O/c1-3-5-15(2)23(30)28-11-10-18(14-28)29(17-8-9-21(27)19(24)12-17)13-16-6-4-7-20(25)22(16)26/h4,6-9,12,15,18H,3,5,10-11,13-14,27H2,1-2H3/t15?,18-/m0/s1 |
| InChIKey | RPYQKVWGXDBSJP-PKHIMPSTSA-N |
| XLogP | 5.24 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.95 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|