C18H20Cl2FN3 — CID 89042099
2-chloro-4-N-[(2-chloro-6-fluorophenyl)methyl]-4-N-[(3S)-1-methylpyrrolidin-3-yl]benzene-1,4-diamine (PubChem CID 89042099) has the molecular formula C18H20Cl2FN3 and a molecular weight of 368.28 g/mol. Its IUPAC name is 2-chloro-4-N-[(2-chloro-6-fluorophenyl)methyl]-4-N-[(3S)-1-methylpyrrolidin-3-yl]benzene-1,4-diamine.
| Compound Name | 2-chloro-4-N-[(2-chloro-6-fluorophenyl)methyl]-4-N-[(3S)-1-methylpyrrolidin-3-yl]benzene-1,4-diamine |
|---|---|
| PubChem CID | 89042099 |
| Molecular Formula | C18H20Cl2FN3 |
| Molecular Weight | 368.28 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 2-chloro-4-N-[(2-chloro-6-fluorophenyl)methyl]-4-N-[(3S)-1-methylpyrrolidin-3-yl]benzene-1,4-diamine |
| SMILES | CN1CC[C@H](N(Cc2c(F)cccc2Cl)c2ccc(N)c(Cl)c2)C1 |
| InChI | InChI=1S/C18H20Cl2FN3/c1-23-8-7-13(10-23)24(12-5-6-18(22)16(20)9-12)11-14-15(19)3-2-4-17(14)21/h2-6,9,13H,7-8,10-11,22H2,1H3/t13-/m0/s1 |
| InChIKey | XBZXBFDUTPINGT-ZDUSSCGKSA-N |
| XLogP | 4.43 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.28 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|