C19H21ClN4 — CID 89042062
3-[(4-amino-3-chloro-N-[(3S)-1-methylpyrrolidin-3-yl]anilino)methyl]benzonitrile (PubChem CID 89042062) has the molecular formula C19H21ClN4 and a molecular weight of 340.86 g/mol. Its IUPAC name is 3-[(4-amino-3-chloro-N-[(3S)-1-methylpyrrolidin-3-yl]anilino)methyl]benzonitrile.
| Compound Name | 3-[(4-amino-3-chloro-N-[(3S)-1-methylpyrrolidin-3-yl]anilino)methyl]benzonitrile |
|---|---|
| PubChem CID | 89042062 |
| Molecular Formula | C19H21ClN4 |
| Molecular Weight | 340.86 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | 3-[(4-amino-3-chloro-N-[(3S)-1-methylpyrrolidin-3-yl]anilino)methyl]benzonitrile |
| SMILES | CN1CC[C@H](N(Cc2cccc(C#N)c2)c2ccc(N)c(Cl)c2)C1 |
| InChI | InChI=1S/C19H21ClN4/c1-23-8-7-17(13-23)24(16-5-6-19(22)18(20)10-16)12-15-4-2-3-14(9-15)11-21/h2-6,9-10,17H,7-8,12-13,22H2,1H3/t17-/m0/s1 |
| InChIKey | RRLFDZCIMPIXBE-KRWDZBQOSA-N |
| XLogP | 3.50 |
| TPSA | 56.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.86 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|