C24H22ClF2N3O — CID 89265758
[(3S)-3-(4-amino-N-benzyl-3-chloroanilino)pyrrolidin-1-yl]-(3,5-difluorophenyl)methanone (PubChem CID 89265758) has the molecular formula C24H22ClF2N3O and a molecular weight of 441.91 g/mol. Its IUPAC name is [(3S)-3-(4-amino-N-benzyl-3-chloroanilino)pyrrolidin-1-yl]-(3,5-difluorophenyl)methanone.
| Compound Name | [(3S)-3-(4-amino-N-benzyl-3-chloroanilino)pyrrolidin-1-yl]-(3,5-difluorophenyl)methanone |
|---|---|
| PubChem CID | 89265758 |
| Molecular Formula | C24H22ClF2N3O |
| Molecular Weight | 441.91 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | [(3S)-3-(4-amino-N-benzyl-3-chloroanilino)pyrrolidin-1-yl]-(3,5-difluorophenyl)methanone |
| SMILES | Nc1ccc(N(Cc2ccccc2)[C@H]2CCN(C(=O)c3cc(F)cc(F)c3)C2)cc1Cl |
| InChI | InChI=1S/C24H22ClF2N3O/c25-22-13-20(6-7-23(22)28)30(14-16-4-2-1-3-5-16)21-8-9-29(15-21)24(31)17-10-18(26)12-19(27)11-17/h1-7,10-13,21H,8-9,14-15,28H2/t21-/m0/s1 |
| InChIKey | MBYODLVWHAPZHN-NRFANRHFSA-N |
| XLogP | 5.12 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.91 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|