C18H20ClN3O — CID 143480526
N-(3-chloro-4-ethynylphenyl)-1-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]pyrrolidin-3-amine (PubChem CID 143480526) has the molecular formula C18H20ClN3O and a molecular weight of 329.83 g/mol. Its IUPAC name is N-(3-chloro-4-ethynylphenyl)-1-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]pyrrolidin-3-amine.
| Compound Name | N-(3-chloro-4-ethynylphenyl)-1-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]pyrrolidin-3-amine |
|---|---|
| PubChem CID | 143480526 |
| Molecular Formula | C18H20ClN3O |
| Molecular Weight | 329.83 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | N-(3-chloro-4-ethynylphenyl)-1-methyl-N-[(5-methyl-1,2-oxazol-3-yl)methyl]pyrrolidin-3-amine |
| SMILES | C#Cc1ccc(N(Cc2cc(C)on2)C2CCN(C)C2)cc1Cl |
| InChI | InChI=1S/C18H20ClN3O/c1-4-14-5-6-16(10-18(14)19)22(17-7-8-21(3)12-17)11-15-9-13(2)23-20-15/h1,5-6,9-10,17H,7-8,11-12H2,2-3H3 |
| InChIKey | FEGJKJCTCVEGAZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 32.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.83 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|