C19H19ClFN3 — CID 59454687
(3S)-N-(3-chloro-4-isocyanophenyl)-N-[(2-fluorophenyl)methyl]-1-methylpyrrolidin-3-amine (PubChem CID 59454687) has the molecular formula C19H19ClFN3 and a molecular weight of 343.83 g/mol. Its IUPAC name is (3S)-N-(3-chloro-4-isocyanophenyl)-N-[(2-fluorophenyl)methyl]-1-methylpyrrolidin-3-amine.
| Compound Name | (3S)-N-(3-chloro-4-isocyanophenyl)-N-[(2-fluorophenyl)methyl]-1-methylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 59454687 |
| Molecular Formula | C19H19ClFN3 |
| Molecular Weight | 343.83 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | (3S)-N-(3-chloro-4-isocyanophenyl)-N-[(2-fluorophenyl)methyl]-1-methylpyrrolidin-3-amine |
| SMILES | [C-]#[N+]c1ccc(N(Cc2ccccc2F)[C@H]2CCN(C)C2)cc1Cl |
| InChI | InChI=1S/C19H19ClFN3/c1-22-19-8-7-15(11-17(19)20)24(16-9-10-23(2)13-16)12-14-5-3-4-6-18(14)21/h3-8,11,16H,9-10,12-13H2,2H3/t16-/m0/s1 |
| InChIKey | LVXYZHRCZHAPCZ-INIZCTEOSA-N |
| XLogP | 4.74 |
| TPSA | 10.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.83 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|