C21H19ClF3N3O2 — CID 59454688
2-[(3S)-3-[3-chloro-4-isocyano-N-[[2-(trifluoromethyl)phenyl]methyl]anilino]pyrrolidin-1-yl]acetic acid (PubChem CID 59454688) has the molecular formula C21H19ClF3N3O2 and a molecular weight of 437.85 g/mol. Its IUPAC name is 2-[(3S)-3-[3-chloro-4-isocyano-N-[[2-(trifluoromethyl)phenyl]methyl]anilino]pyrrolidin-1-yl]acetic acid.
| Compound Name | 2-[(3S)-3-[3-chloro-4-isocyano-N-[[2-(trifluoromethyl)phenyl]methyl]anilino]pyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 59454688 |
| Molecular Formula | C21H19ClF3N3O2 |
| Molecular Weight | 437.85 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | 2-[(3S)-3-[3-chloro-4-isocyano-N-[[2-(trifluoromethyl)phenyl]methyl]anilino]pyrrolidin-1-yl]acetic acid |
| SMILES | [C-]#[N+]c1ccc(N(Cc2ccccc2C(F)(F)F)[C@H]2CCN(CC(=O)O)C2)cc1Cl |
| InChI | InChI=1S/C21H19ClF3N3O2/c1-26-19-7-6-15(10-18(19)22)28(16-8-9-27(12-16)13-20(29)30)11-14-4-2-3-5-17(14)21(23,24)25/h2-7,10,16H,8-9,11-13H2,(H,29,30)/t16-/m0/s1 |
| InChIKey | BTPWTSLTBODMHN-INIZCTEOSA-N |
| XLogP | 5.08 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.85 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|